C11H17N7 — CID 107066382
[1-(3,5-dimethyl-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine (PubChem CID 107066382) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is [1-(3,5-dimethyl-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine.
| Compound Name | [1-(3,5-dimethyl-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107066382 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | [1-(3,5-dimethyl-2-pyridinyl)-2-(2-methyltetrazol-5-yl)ethyl]hydrazine |
| SMILES | Cc1cnc(C(Cc2nnn(C)n2)NN)c(C)c1 |
| InChI | InChI=1S/C11H17N7/c1-7-4-8(2)11(13-6-7)9(14-12)5-10-15-17-18(3)16-10/h4,6,9,14H,5,12H2,1-3H3 |
| InChIKey | AUKMTQZZRQXLRT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|