C11H13N7S — CID 107066315
[2-(2-methyltetrazol-5-yl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine (PubChem CID 107066315) has the molecular formula C11H13N7S and a molecular weight of 275.34 g/mol. Its IUPAC name is [2-(2-methyltetrazol-5-yl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine.
| Compound Name | [2-(2-methyltetrazol-5-yl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 107066315 |
| Molecular Formula | C11H13N7S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [2-(2-methyltetrazol-5-yl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine |
| SMILES | Cn1nnc(CC(NN)c2cnc3ccsc3c2)n1 |
| InChI | InChI=1S/C11H13N7S/c1-18-16-11(15-17-18)5-9(14-12)7-4-10-8(13-6-7)2-3-19-10/h2-4,6,9,14H,5,12H2,1H3 |
| InChIKey | ZFLLXTXNBYWXLT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|