C12H17N3S — CID 105256514
(2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropyl)hydrazine (PubChem CID 105256514) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is (2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropyl)hydrazine.
| Compound Name | (2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropyl)hydrazine |
|---|---|
| PubChem CID | 105256514 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2,2-dimethyl-1-thieno[3,2-b]pyridin-6-ylpropyl)hydrazine |
| SMILES | CC(C)(C)C(NN)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C12H17N3S/c1-12(2,3)11(15-13)8-6-10-9(14-7-8)4-5-16-10/h4-7,11,15H,13H2,1-3H3 |
| InChIKey | STKFURVDDPYWPR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|