C11H15N3S — CID 64830566
N'-(1-thieno[3,2-b]pyridin-6-ylethyl)ethane-1,2-diamine (PubChem CID 64830566) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N'-(1-thieno[3,2-b]pyridin-6-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-(1-thieno[3,2-b]pyridin-6-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 64830566 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N'-(1-thieno[3,2-b]pyridin-6-ylethyl)ethane-1,2-diamine |
| SMILES | CC(NCCN)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C11H15N3S/c1-8(13-4-3-12)9-6-11-10(14-7-9)2-5-15-11/h2,5-8,13H,3-4,12H2,1H3 |
| InChIKey | HPOCRXSBQVVRST-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |