About 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol
4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol (PubChem CID 64830374) has the molecular formula C17H18N2OS
and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol |
| PubChem CID | 64830374 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol |
| SMILES | CC(NCCc1ccc(O)cc1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C17H18N2OS/c1-12(14-10-17-16(19-11-14)7-9-21-17)18-8-6-13-2-4-15(20)5-3-13/h2-5,7,9-12,18,20H,6,8H2,1H3 |
| InChIKey | KRXUOTOADWDORU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol?
The IUPAC name of 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol (CID 64830374) is 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol.
What is the SMILES notation for 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol?
The canonical SMILES for 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol is CC(NCCc1ccc(O)cc1)c1cnc2ccsc2c1.
What is the InChIKey of 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol?
The InChIKey is KRXUOTOADWDORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2OS/c1-12(14-10-17-16(19-11-14)7-9-21-17)18-8-6-13-2-4-15(20)5-3-13/h2-5,7,9-12,18,20H,6,8H2,1H3.
What are the key properties of 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol?
4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol has a molecular weight of 298.41 g/mol, XLogP of 3.90, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-thieno[3,2-b]pyridin-6-ylethylamino)ethyl]phenol is sourced from PubChem (CID 64830374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).