About N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine
N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine (PubChem CID 64830758) has the molecular formula C13H19N3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine |
| PubChem CID | 64830758 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine |
| SMILES | CC(NCCCCN)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C13H19N3S/c1-10(15-6-3-2-5-14)11-8-13-12(16-9-11)4-7-17-13/h4,7-10,15H,2-3,5-6,14H2,1H3 |
| InChIKey | JKQMKEJCDZUSLI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine?
The IUPAC name of N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine (CID 64830758) is N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine.
What is the SMILES notation for N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine?
The canonical SMILES for N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine is CC(NCCCCN)c1cnc2ccsc2c1.
What is the InChIKey of N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine?
The InChIKey is JKQMKEJCDZUSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3S/c1-10(15-6-3-2-5-14)11-8-13-12(16-9-11)4-7-17-13/h4,7-10,15H,2-3,5-6,14H2,1H3.
What are the key properties of N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine?
N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine has a molecular weight of 249.38 g/mol, XLogP of 2.69, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-thieno[3,2-b]pyridin-6-ylethyl)butane-1,4-diamine is sourced from PubChem (CID 64830758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).