C13H19N3S — CID 105256494
(3-methyl-1-thieno[3,2-b]pyridin-6-ylpentyl)hydrazine (PubChem CID 105256494) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is (3-methyl-1-thieno[3,2-b]pyridin-6-ylpentyl)hydrazine.
| Compound Name | (3-methyl-1-thieno[3,2-b]pyridin-6-ylpentyl)hydrazine |
|---|---|
| PubChem CID | 105256494 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (3-methyl-1-thieno[3,2-b]pyridin-6-ylpentyl)hydrazine |
| SMILES | CCC(C)CC(NN)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C13H19N3S/c1-3-9(2)6-12(16-14)10-7-13-11(15-8-10)4-5-17-13/h4-5,7-9,12,16H,3,6,14H2,1-2H3 |
| InChIKey | XQMKLTLGASJLMA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|