C17H26N2S — CID 81143975
3-ethyl-N-methyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-amine (PubChem CID 81143975) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is 3-ethyl-N-methyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-amine.
| Compound Name | 3-ethyl-N-methyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-amine |
|---|---|
| PubChem CID | 81143975 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-ethyl-N-methyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-amine |
| SMILES | CCCCC(CC)CC(NC)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C17H26N2S/c1-4-6-7-13(5-2)10-16(18-3)14-11-17-15(19-12-14)8-9-20-17/h8-9,11-13,16,18H,4-7,10H2,1-3H3 |
| InChIKey | IFTSOGKZHJYOFF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |