C16H21NOS — CID 81144218
3-ethyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-one (PubChem CID 81144218) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-ethyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-one.
| Compound Name | 3-ethyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-one |
|---|---|
| PubChem CID | 81144218 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-ethyl-1-thieno[3,2-b]pyridin-6-ylheptan-1-one |
| SMILES | CCCCC(CC)CC(=O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C16H21NOS/c1-3-5-6-12(4-2)9-15(18)13-10-16-14(17-11-13)7-8-19-16/h7-8,10-12H,3-6,9H2,1-2H3 |
| InChIKey | AXXCLHZNLWZQCM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |