C13H13NOS — CID 81147598
3-methylidene-1-thieno[3,2-b]pyridin-6-ylpentan-1-one (PubChem CID 81147598) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-methylidene-1-thieno[3,2-b]pyridin-6-ylpentan-1-one.
| Compound Name | 3-methylidene-1-thieno[3,2-b]pyridin-6-ylpentan-1-one |
|---|---|
| PubChem CID | 81147598 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-methylidene-1-thieno[3,2-b]pyridin-6-ylpentan-1-one |
| SMILES | C=C(CC)CC(=O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C13H13NOS/c1-3-9(2)6-12(15)10-7-13-11(14-8-10)4-5-16-13/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | KPAZVMURUSOIAN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|