C15H17NOS — CID 81146664
2-cyclohexyl-1-thieno[3,2-b]pyridin-6-ylethanone (PubChem CID 81146664) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-cyclohexyl-1-thieno[3,2-b]pyridin-6-ylethanone.
| Compound Name | 2-cyclohexyl-1-thieno[3,2-b]pyridin-6-ylethanone |
|---|---|
| PubChem CID | 81146664 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-cyclohexyl-1-thieno[3,2-b]pyridin-6-ylethanone |
| SMILES | O=C(CC1CCCCC1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H17NOS/c17-14(8-11-4-2-1-3-5-11)12-9-15-13(16-10-12)6-7-18-15/h6-7,9-11H,1-5,8H2 |
| InChIKey | GCWPARVZNGFWJO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |