C16H13NOS — CID 81148519
2-(2-methylphenyl)-1-thieno[3,2-b]pyridin-6-ylethanone (PubChem CID 81148519) has the molecular formula C16H13NOS and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-thieno[3,2-b]pyridin-6-ylethanone.
| Compound Name | 2-(2-methylphenyl)-1-thieno[3,2-b]pyridin-6-ylethanone |
|---|---|
| PubChem CID | 81148519 |
| Molecular Formula | C16H13NOS |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-(2-methylphenyl)-1-thieno[3,2-b]pyridin-6-ylethanone |
| SMILES | Cc1ccccc1CC(=O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C16H13NOS/c1-11-4-2-3-5-12(11)8-15(18)13-9-16-14(17-10-13)6-7-19-16/h2-7,9-10H,8H2,1H3 |
| InChIKey | BTUWJKANCUUAOZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |