C11H7NOS — CID 81147974
1-thieno[3,2-b]pyridin-6-ylbut-3-yn-1-one (PubChem CID 81147974) has the molecular formula C11H7NOS and a molecular weight of 201.25 g/mol. Its IUPAC name is 1-thieno[3,2-b]pyridin-6-ylbut-3-yn-1-one.
| Compound Name | 1-thieno[3,2-b]pyridin-6-ylbut-3-yn-1-one |
|---|---|
| PubChem CID | 81147974 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 1-thieno[3,2-b]pyridin-6-ylbut-3-yn-1-one |
| SMILES | C#CCC(=O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C11H7NOS/c1-2-3-10(13)8-6-11-9(12-7-8)4-5-14-11/h1,4-7H,3H2 |
| InChIKey | TUVLDBYFHRGMEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|