C13H9NO2S — CID 83171844
2-(furan-3-yl)-1-thieno[3,2-b]pyridin-6-ylethanone (PubChem CID 83171844) has the molecular formula C13H9NO2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-thieno[3,2-b]pyridin-6-ylethanone.
| Compound Name | 2-(furan-3-yl)-1-thieno[3,2-b]pyridin-6-ylethanone |
|---|---|
| PubChem CID | 83171844 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-(furan-3-yl)-1-thieno[3,2-b]pyridin-6-ylethanone |
| SMILES | O=C(Cc1ccoc1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C13H9NO2S/c15-12(5-9-1-3-16-8-9)10-6-13-11(14-7-10)2-4-17-13/h1-4,6-8H,5H2 |
| InChIKey | JUBLETZIMXQYAZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |