C15H22N2S — CID 81143501
N,3-dimethyl-1-thieno[3,2-b]pyridin-6-ylhexan-1-amine (PubChem CID 81143501) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N,3-dimethyl-1-thieno[3,2-b]pyridin-6-ylhexan-1-amine.
| Compound Name | N,3-dimethyl-1-thieno[3,2-b]pyridin-6-ylhexan-1-amine |
|---|---|
| PubChem CID | 81143501 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N,3-dimethyl-1-thieno[3,2-b]pyridin-6-ylhexan-1-amine |
| SMILES | CCCC(C)CC(NC)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H22N2S/c1-4-5-11(2)8-14(16-3)12-9-15-13(17-10-12)6-7-18-15/h6-7,9-11,14,16H,4-5,8H2,1-3H3 |
| InChIKey | RTFMTTKACDLLKW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |