C15H22N2S — CID 64828654
N-(1-thieno[3,2-b]pyridin-6-ylethyl)hexan-3-amine (PubChem CID 64828654) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(1-thieno[3,2-b]pyridin-6-ylethyl)hexan-3-amine.
| Compound Name | N-(1-thieno[3,2-b]pyridin-6-ylethyl)hexan-3-amine |
|---|---|
| PubChem CID | 64828654 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(1-thieno[3,2-b]pyridin-6-ylethyl)hexan-3-amine |
| SMILES | CCCC(CC)NC(C)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H22N2S/c1-4-6-13(5-2)17-11(3)12-9-15-14(16-10-12)7-8-18-15/h7-11,13,17H,4-6H2,1-3H3 |
| InChIKey | HINVEERRNNONQW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |