C12H14N2S — CID 81143014
3-methyl-1-thieno[3,2-b]pyridin-6-ylbut-2-en-1-amine (PubChem CID 81143014) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-methyl-1-thieno[3,2-b]pyridin-6-ylbut-2-en-1-amine.
| Compound Name | 3-methyl-1-thieno[3,2-b]pyridin-6-ylbut-2-en-1-amine |
|---|---|
| PubChem CID | 81143014 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3-methyl-1-thieno[3,2-b]pyridin-6-ylbut-2-en-1-amine |
| SMILES | CC(C)=CC(N)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C12H14N2S/c1-8(2)5-10(13)9-6-12-11(14-7-9)3-4-15-12/h3-7,10H,13H2,1-2H3 |
| InChIKey | KYMRXMHWYMAOTB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|