C11H11NOS — CID 81144232
1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol (PubChem CID 81144232) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol.
| Compound Name | 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol |
|---|---|
| PubChem CID | 81144232 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol |
| SMILES | C=CCC(O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C11H11NOS/c1-2-3-10(13)8-6-11-9(12-7-8)4-5-14-11/h2,4-7,10,13H,1,3H2 |
| InChIKey | FEGYIIFIIVVFDQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|