About 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol
1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol (PubChem CID 81144232) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol.
Molecular Properties
| Compound Name | 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol |
| PubChem CID | 81144232 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol |
| SMILES | C=CCC(O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C11H11NOS/c1-2-3-10(13)8-6-11-9(12-7-8)4-5-14-11/h2,4-7,10,13H,1,3H2 |
| InChIKey | FEGYIIFIIVVFDQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol?
The IUPAC name of 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol (CID 81144232) is 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol.
What is the SMILES notation for 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol?
The canonical SMILES for 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol is C=CCC(O)c1cnc2ccsc2c1.
What is the InChIKey of 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol?
The InChIKey is FEGYIIFIIVVFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c1-2-3-10(13)8-6-11-9(12-7-8)4-5-14-11/h2,4-7,10,13H,1,3H2.
What are the key properties of 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol?
1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol has a molecular weight of 205.28 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[3,2-b]pyridin-6-ylbut-3-en-1-ol is sourced from PubChem (CID 81144232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).