C15H11Cl2NOS — CID 81143648
2-(2,6-dichlorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol (PubChem CID 81143648) has the molecular formula C15H11Cl2NOS and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol |
|---|---|
| PubChem CID | 81143648 |
| Molecular Formula | C15H11Cl2NOS |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol |
| SMILES | OC(Cc1c(Cl)cccc1Cl)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H11Cl2NOS/c16-11-2-1-3-12(17)10(11)7-14(19)9-6-15-13(18-8-9)4-5-20-15/h1-6,8,14,19H,7H2 |
| InChIKey | DXYFKKGJQCSSAB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |