C18H19NOS — CID 116543760
[3-(2-methylpropyl)phenyl]-thieno[3,2-b]pyridin-6-ylmethanol (PubChem CID 116543760) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is [3-(2-methylpropyl)phenyl]-thieno[3,2-b]pyridin-6-ylmethanol.
| Compound Name | [3-(2-methylpropyl)phenyl]-thieno[3,2-b]pyridin-6-ylmethanol |
|---|---|
| PubChem CID | 116543760 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [3-(2-methylpropyl)phenyl]-thieno[3,2-b]pyridin-6-ylmethanol |
| SMILES | CC(C)Cc1cccc(C(O)c2cnc3ccsc3c2)c1 |
| InChI | InChI=1S/C18H19NOS/c1-12(2)8-13-4-3-5-14(9-13)18(20)15-10-17-16(19-11-15)6-7-21-17/h3-7,9-12,18,20H,8H2,1-2H3 |
| InChIKey | RSJLSSQBZXECMN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |