C14H9F2NOS — CID 81144116
(3,5-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanol (PubChem CID 81144116) has the molecular formula C14H9F2NOS and a molecular weight of 277.30 g/mol. Its IUPAC name is (3,5-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanol.
| Compound Name | (3,5-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanol |
|---|---|
| PubChem CID | 81144116 |
| Molecular Formula | C14H9F2NOS |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (3,5-difluorophenyl)-thieno[3,2-b]pyridin-6-ylmethanol |
| SMILES | OC(c1cc(F)cc(F)c1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H9F2NOS/c15-10-3-8(4-11(16)6-10)14(18)9-5-13-12(17-7-9)1-2-19-13/h1-7,14,18H |
| InChIKey | MCSFKCOBNZOXPV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |