C15H13BrFN3S — CID 105256410
[2-(3-bromo-5-fluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine (PubChem CID 105256410) has the molecular formula C15H13BrFN3S and a molecular weight of 366.26 g/mol. Its IUPAC name is [2-(3-bromo-5-fluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine.
| Compound Name | [2-(3-bromo-5-fluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105256410 |
| Molecular Formula | C15H13BrFN3S |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | [2-(3-bromo-5-fluorophenyl)-1-thieno[3,2-b]pyridin-6-ylethyl]hydrazine |
| SMILES | NNC(Cc1cc(F)cc(Br)c1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H13BrFN3S/c16-11-3-9(4-12(17)7-11)5-14(20-18)10-6-15-13(19-8-10)1-2-21-15/h1-4,6-8,14,20H,5,18H2 |
| InChIKey | NVPKGBGJKSQSBG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|