C15H12BrNOS — CID 81144222
2-(4-bromophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol (PubChem CID 81144222) has the molecular formula C15H12BrNOS and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol.
| Compound Name | 2-(4-bromophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol |
|---|---|
| PubChem CID | 81144222 |
| Molecular Formula | C15H12BrNOS |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 2-(4-bromophenyl)-1-thieno[3,2-b]pyridin-6-ylethanol |
| SMILES | OC(Cc1ccc(Br)cc1)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C15H12BrNOS/c16-12-3-1-10(2-4-12)7-14(18)11-8-15-13(17-9-11)5-6-19-15/h1-6,8-9,14,18H,7H2 |
| InChIKey | LIERWBBPTLKPRI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |