C14H11ClN2OS — CID 81143765
2-(3-chloro-4-pyridinyl)-1-thieno[3,2-b]pyridin-6-ylethanol (PubChem CID 81143765) has the molecular formula C14H11ClN2OS and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-(3-chloro-4-pyridinyl)-1-thieno[3,2-b]pyridin-6-ylethanol.
| Compound Name | 2-(3-chloro-4-pyridinyl)-1-thieno[3,2-b]pyridin-6-ylethanol |
|---|---|
| PubChem CID | 81143765 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-(3-chloro-4-pyridinyl)-1-thieno[3,2-b]pyridin-6-ylethanol |
| SMILES | OC(Cc1ccncc1Cl)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H11ClN2OS/c15-11-8-16-3-1-9(11)5-13(18)10-6-14-12(17-7-10)2-4-19-14/h1-4,6-8,13,18H,5H2 |
| InChIKey | JEIPGVNBCDSCKT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |