C13H9BrClNS2 — CID 112656055
4-(2-bromo-2-thieno[3,2-b]thiophen-5-ylethyl)-3-chloropyridine (PubChem CID 112656055) has the molecular formula C13H9BrClNS2 and a molecular weight of 358.71 g/mol. Its IUPAC name is 4-(2-bromo-2-thieno[3,2-b]thiophen-5-ylethyl)-3-chloropyridine.
| Compound Name | 4-(2-bromo-2-thieno[3,2-b]thiophen-5-ylethyl)-3-chloropyridine |
|---|---|
| PubChem CID | 112656055 |
| Molecular Formula | C13H9BrClNS2 |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 356.90 |
| IUPAC Name | 4-(2-bromo-2-thieno[3,2-b]thiophen-5-ylethyl)-3-chloropyridine |
| SMILES | Clc1cnccc1CC(Br)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H9BrClNS2/c14-9(5-8-1-3-16-7-10(8)15)12-6-13-11(18-12)2-4-17-13/h1-4,6-7,9H,5H2 |
| InChIKey | SRTOJUYASOUUQQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|