C14H12ClNS2 — CID 80745793
2-(2-chlorophenyl)-1-thieno[3,2-b]thiophen-5-ylethanamine (PubChem CID 80745793) has the molecular formula C14H12ClNS2 and a molecular weight of 293.84 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-thieno[3,2-b]thiophen-5-ylethanamine.
| Compound Name | 2-(2-chlorophenyl)-1-thieno[3,2-b]thiophen-5-ylethanamine |
|---|---|
| PubChem CID | 80745793 |
| Molecular Formula | C14H12ClNS2 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-(2-chlorophenyl)-1-thieno[3,2-b]thiophen-5-ylethanamine |
| SMILES | NC(Cc1ccccc1Cl)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H12ClNS2/c15-10-4-2-1-3-9(10)7-11(16)13-8-14-12(18-13)5-6-17-14/h1-6,8,11H,7,16H2 |
| InChIKey | HYRLKFIZSGJQBS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |