C10H13NOS2 — CID 105008209
2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanamine (PubChem CID 105008209) has the molecular formula C10H13NOS2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanamine.
| Compound Name | 2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanamine |
|---|---|
| PubChem CID | 105008209 |
| Molecular Formula | C10H13NOS2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 2-ethoxy-1-thieno[3,2-b]thiophen-5-ylethanamine |
| SMILES | CCOCC(N)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H13NOS2/c1-2-12-6-7(11)9-5-10-8(14-9)3-4-13-10/h3-5,7H,2,6,11H2,1H3 |
| InChIKey | NDEKMAUONHSNID-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |