C17H27NS2 — CID 115846032
1-thieno[3,2-b]thiophen-5-ylundecan-1-amine (PubChem CID 115846032) has the molecular formula C17H27NS2 and a molecular weight of 309.54 g/mol. Its IUPAC name is 1-thieno[3,2-b]thiophen-5-ylundecan-1-amine.
| Compound Name | 1-thieno[3,2-b]thiophen-5-ylundecan-1-amine |
|---|---|
| PubChem CID | 115846032 |
| Molecular Formula | C17H27NS2 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-thieno[3,2-b]thiophen-5-ylundecan-1-amine |
| SMILES | CCCCCCCCCCC(N)c1cc2sccc2s1 |
| InChI | InChI=1S/C17H27NS2/c1-2-3-4-5-6-7-8-9-10-14(18)16-13-17-15(20-16)11-12-19-17/h11-14H,2-10,18H2,1H3 |
| InChIKey | FNUANFIVSNAYSV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|