C14H20OS2 — CID 115783186
1-thieno[3,2-b]thiophen-5-yloctan-1-ol (PubChem CID 115783186) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-thieno[3,2-b]thiophen-5-yloctan-1-ol.
| Compound Name | 1-thieno[3,2-b]thiophen-5-yloctan-1-ol |
|---|---|
| PubChem CID | 115783186 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-thieno[3,2-b]thiophen-5-yloctan-1-ol |
| SMILES | CCCCCCCC(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H20OS2/c1-2-3-4-5-6-7-11(15)13-10-14-12(17-13)8-9-16-14/h8-11,15H,2-7H2,1H3 |
| InChIKey | SNTYGZKTAUOFKL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|