C10H14N2S2 — CID 105282348
1-thieno[3,2-b]thiophen-5-ylbutylhydrazine (PubChem CID 105282348) has the molecular formula C10H14N2S2 and a molecular weight of 226.37 g/mol. Its IUPAC name is 1-thieno[3,2-b]thiophen-5-ylbutylhydrazine.
| Compound Name | 1-thieno[3,2-b]thiophen-5-ylbutylhydrazine |
|---|---|
| PubChem CID | 105282348 |
| Molecular Formula | C10H14N2S2 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-thieno[3,2-b]thiophen-5-ylbutylhydrazine |
| SMILES | CCCC(NN)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H14N2S2/c1-2-3-7(12-11)9-6-10-8(14-9)4-5-13-10/h4-7,12H,2-3,11H2,1H3 |
| InChIKey | VUWJWZDSOMALOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|