C12H12N2S3 — CID 102843257
[(2-methylthiophen-3-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine (PubChem CID 102843257) has the molecular formula C12H12N2S3 and a molecular weight of 280.44 g/mol. Its IUPAC name is [(2-methylthiophen-3-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine.
| Compound Name | [(2-methylthiophen-3-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 102843257 |
| Molecular Formula | C12H12N2S3 |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | [(2-methylthiophen-3-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine |
| SMILES | Cc1sccc1C(NN)c1cc2sccc2s1 |
| InChI | InChI=1S/C12H12N2S3/c1-7-8(2-4-15-7)12(14-13)11-6-10-9(17-11)3-5-16-10/h2-6,12,14H,13H2,1H3 |
| InChIKey | YGWCSPXQWIQSHR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|