C10H10Br2N2S2 — CID 107970684
[(2,5-dibromothiophen-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine (PubChem CID 107970684) has the molecular formula C10H10Br2N2S2 and a molecular weight of 382.15 g/mol. Its IUPAC name is [(2,5-dibromothiophen-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine.
| Compound Name | [(2,5-dibromothiophen-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107970684 |
| Molecular Formula | C10H10Br2N2S2 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 379.87 |
| IUPAC Name | [(2,5-dibromothiophen-3-yl)-(2-methylthiophen-3-yl)methyl]hydrazine |
| SMILES | Cc1sccc1C(NN)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H10Br2N2S2/c1-5-6(2-3-15-5)9(14-13)7-4-8(11)16-10(7)12/h2-4,9,14H,13H2,1H3 |
| InChIKey | OLKXIGDMDTZYDF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|