C11H11BrN4S2 — CID 105342289
[(4-bromo-1-methylpyrazol-5-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine (PubChem CID 105342289) has the molecular formula C11H11BrN4S2 and a molecular weight of 343.28 g/mol. Its IUPAC name is [(4-bromo-1-methylpyrazol-5-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine.
| Compound Name | [(4-bromo-1-methylpyrazol-5-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine |
|---|---|
| PubChem CID | 105342289 |
| Molecular Formula | C11H11BrN4S2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | [(4-bromo-1-methylpyrazol-5-yl)-thieno[3,2-b]thiophen-5-ylmethyl]hydrazine |
| SMILES | Cn1ncc(Br)c1C(NN)c1cc2sccc2s1 |
| InChI | InChI=1S/C11H11BrN4S2/c1-16-11(6(12)5-14-16)10(15-13)9-4-8-7(18-9)2-3-17-8/h2-5,10,15H,13H2,1H3 |
| InChIKey | GEXSLBLDVDOEEE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|