C10H12OS2 — CID 115780945
1-thieno[3,2-b]thiophen-5-ylbutan-1-ol (PubChem CID 115780945) has the molecular formula C10H12OS2 and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-thieno[3,2-b]thiophen-5-ylbutan-1-ol.
| Compound Name | 1-thieno[3,2-b]thiophen-5-ylbutan-1-ol |
|---|---|
| PubChem CID | 115780945 |
| Molecular Formula | C10H12OS2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 1-thieno[3,2-b]thiophen-5-ylbutan-1-ol |
| SMILES | CCCC(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H12OS2/c1-2-3-7(11)9-6-10-8(13-9)4-5-12-10/h4-7,11H,2-3H2,1H3 |
| InChIKey | BCRCSEBAEONGIQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |