C12H17NO2S3 — CID 104986246
4-ethylsulfonyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine (PubChem CID 104986246) has the molecular formula C12H17NO2S3 and a molecular weight of 303.47 g/mol. Its IUPAC name is 4-ethylsulfonyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine.
| Compound Name | 4-ethylsulfonyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine |
|---|---|
| PubChem CID | 104986246 |
| Molecular Formula | C12H17NO2S3 |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-ethylsulfonyl-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCCC(N)c1cc2sccc2s1 |
| InChI | InChI=1S/C12H17NO2S3/c1-2-18(14,15)7-3-4-9(13)11-8-12-10(17-11)5-6-16-12/h5-6,8-9H,2-4,7,13H2,1H3 |
| InChIKey | KWKKFUXGQAYFDL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |