C10H10F3NS2 — CID 104992946
4,4,4-trifluoro-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine (PubChem CID 104992946) has the molecular formula C10H10F3NS2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine.
| Compound Name | 4,4,4-trifluoro-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine |
|---|---|
| PubChem CID | 104992946 |
| Molecular Formula | C10H10F3NS2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4,4,4-trifluoro-1-thieno[3,2-b]thiophen-5-ylbutan-1-amine |
| SMILES | NC(CCC(F)(F)F)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H10F3NS2/c11-10(12,13)3-1-6(14)8-5-9-7(16-8)2-4-15-9/h2,4-6H,1,3,14H2 |
| InChIKey | VCBTWBQGJVRZQQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |