C10H13NO2S3 — CID 115848689
3-methylsulfonyl-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine (PubChem CID 115848689) has the molecular formula C10H13NO2S3 and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-methylsulfonyl-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine.
| Compound Name | 3-methylsulfonyl-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine |
|---|---|
| PubChem CID | 115848689 |
| Molecular Formula | C10H13NO2S3 |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 3-methylsulfonyl-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine |
| SMILES | CS(=O)(=O)CCC(N)c1cc2sccc2s1 |
| InChI | InChI=1S/C10H13NO2S3/c1-16(12,13)5-3-7(11)9-6-10-8(15-9)2-4-14-10/h2,4,6-7H,3,5,11H2,1H3 |
| InChIKey | DMTZQLKDRUNYEA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |