C16H17NOS2 — CID 115864800
3-(4-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine (PubChem CID 115864800) has the molecular formula C16H17NOS2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine.
| Compound Name | 3-(4-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine |
|---|---|
| PubChem CID | 115864800 |
| Molecular Formula | C16H17NOS2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylpropan-1-amine |
| SMILES | COc1ccc(CCC(N)c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C16H17NOS2/c1-18-12-5-2-11(3-6-12)4-7-13(17)15-10-16-14(20-15)8-9-19-16/h2-3,5-6,8-10,13H,4,7,17H2,1H3 |
| InChIKey | DGQFFISGUKBZEV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |