C16H16O2S2 — CID 80746017
[4-(2-methoxyethyl)phenyl]-thieno[3,2-b]thiophen-5-ylmethanol (PubChem CID 80746017) has the molecular formula C16H16O2S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is [4-(2-methoxyethyl)phenyl]-thieno[3,2-b]thiophen-5-ylmethanol.
| Compound Name | [4-(2-methoxyethyl)phenyl]-thieno[3,2-b]thiophen-5-ylmethanol |
|---|---|
| PubChem CID | 80746017 |
| Molecular Formula | C16H16O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | [4-(2-methoxyethyl)phenyl]-thieno[3,2-b]thiophen-5-ylmethanol |
| SMILES | COCCc1ccc(C(O)c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C16H16O2S2/c1-18-8-6-11-2-4-12(5-3-11)16(17)15-10-14-13(20-15)7-9-19-14/h2-5,7,9-10,16-17H,6,8H2,1H3 |
| InChIKey | SWNCLQFECVJMIA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |