C14H13NO2S2 — CID 115829098
(5-ethoxy-3-pyridinyl)-thieno[3,2-b]thiophen-5-ylmethanol (PubChem CID 115829098) has the molecular formula C14H13NO2S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is (5-ethoxy-3-pyridinyl)-thieno[3,2-b]thiophen-5-ylmethanol.
| Compound Name | (5-ethoxy-3-pyridinyl)-thieno[3,2-b]thiophen-5-ylmethanol |
|---|---|
| PubChem CID | 115829098 |
| Molecular Formula | C14H13NO2S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (5-ethoxy-3-pyridinyl)-thieno[3,2-b]thiophen-5-ylmethanol |
| SMILES | CCOc1cncc(C(O)c2cc3sccc3s2)c1 |
| InChI | InChI=1S/C14H13NO2S2/c1-2-17-10-5-9(7-15-8-10)14(16)13-6-12-11(19-13)3-4-18-12/h3-8,14,16H,2H2,1H3 |
| InChIKey | SFJLROJTNKOMBY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |