C13H10OS2 — CID 135070727
5-(4-methoxyphenyl)thieno[3,2-b]thiophene (PubChem CID 135070727) has the molecular formula C13H10OS2 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)thieno[3,2-b]thiophene.
| Compound Name | 5-(4-methoxyphenyl)thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 135070727 |
| Molecular Formula | C13H10OS2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 5-(4-methoxyphenyl)thieno[3,2-b]thiophene |
| SMILES | COc1ccc(-c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C13H10OS2/c1-14-10-4-2-9(3-5-10)12-8-13-11(16-12)6-7-15-13/h2-8H,1H3 |
| InChIKey | UXDVWDAFHFLWPX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |