About 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene
5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene (PubChem CID 123978480) has the molecular formula C12H6S4
and a molecular weight of 278.45 g/mol. Its IUPAC name is 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene.
Analyze 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene?
The IUPAC name of 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene (CID 123978480) is 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene.
What is the SMILES notation for 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene?
The canonical SMILES for 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene is c1cc2sc(-c3cc4ccsc4s3)cc2s1.
What is the InChIKey of 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene?
The InChIKey is FOFKDJYJAOWPMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6S4/c1-3-14-12-7(1)5-10(16-12)11-6-9-8(15-11)2-4-13-9/h1-6H.
What are the key properties of 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene?
5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene has a molecular weight of 278.45 g/mol, XLogP of 5.91, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-thieno[2,3-b]thiophen-5-ylthieno[3,2-b]thiophene is sourced from PubChem (CID 123978480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).