C14H6S5 — CID 123797462
3-thieno[2,3-b]thiophen-5-yl-5,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene (PubChem CID 123797462) has the molecular formula C14H6S5 and a molecular weight of 334.54 g/mol. Its IUPAC name is 3-thieno[2,3-b]thiophen-5-yl-5,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene.
| Compound Name | 3-thieno[2,3-b]thiophen-5-yl-5,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene |
|---|---|
| PubChem CID | 123797462 |
| Molecular Formula | C14H6S5 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 333.91 |
| IUPAC Name | 3-thieno[2,3-b]thiophen-5-yl-5,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),3,10-tetraene |
| SMILES | c1cc2cc(-c3csc4sc5sccc5c34)sc2s1 |
| InChI | InChI=1S/C14H6S5/c1-3-15-12-7(1)5-10(18-12)9-6-17-14-11(9)8-2-4-16-13(8)19-14/h1-6H |
| InChIKey | ROBLLJNICIQRSQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |