C16H12N2S2 — CID 167260861
12-(3,5-dimethylphenyl)-5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene (PubChem CID 167260861) has the molecular formula C16H12N2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 12-(3,5-dimethylphenyl)-5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene.
| Compound Name | 12-(3,5-dimethylphenyl)-5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene |
|---|---|
| PubChem CID | 167260861 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 12-(3,5-dimethylphenyl)-5,7-dithia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),3,8,10-pentaene |
| SMILES | Cc1cc(C)cc(-c2ncnc3sc4sccc4c23)c1 |
| InChI | InChI=1S/C16H12N2S2/c1-9-5-10(2)7-11(6-9)14-13-12-3-4-19-16(12)20-15(13)18-8-17-14/h3-8H,1-2H3 |
| InChIKey | IPGHLVLJADRGOI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |