C14H15N — CID 164805039
2-(3,5-dimethylphenyl)-5-(trideuteriomethyl)pyridine (PubChem CID 164805039) has the molecular formula C14H15N and a molecular weight of 200.30 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-5-(trideuteriomethyl)pyridine.
| Compound Name | 2-(3,5-dimethylphenyl)-5-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 164805039 |
| Molecular Formula | C14H15N |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-5-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc(C)cc(C)c2)nc1 |
| InChI | InChI=1S/C14H15N/c1-10-4-5-14(15-9-10)13-7-11(2)6-12(3)8-13/h4-9H,1-3H3/i1D3 |
| InChIKey | NHNFKPNWSLRMEP-FIBGUPNXSA-N |
| XLogP | 3.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |