C12H8F3N — CID 168823076
5-methyl-2-(3,4,5-trifluorophenyl)pyridine (PubChem CID 168823076) has the molecular formula C12H8F3N and a molecular weight of 223.20 g/mol. Its IUPAC name is 5-methyl-2-(3,4,5-trifluorophenyl)pyridine.
| Compound Name | 5-methyl-2-(3,4,5-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 168823076 |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 5-methyl-2-(3,4,5-trifluorophenyl)pyridine |
| SMILES | Cc1ccc(-c2cc(F)c(F)c(F)c2)nc1 |
| InChI | InChI=1S/C12H8F3N/c1-7-2-3-11(16-6-7)8-4-9(13)12(15)10(14)5-8/h2-6H,1H3 |
| InChIKey | ZJZHIPLJRPMJIO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|