C18H13F2N — CID 59294841
2-[3-(2,3-difluorophenyl)phenyl]-5-methylpyridine (PubChem CID 59294841) has the molecular formula C18H13F2N and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[3-(2,3-difluorophenyl)phenyl]-5-methylpyridine.
| Compound Name | 2-[3-(2,3-difluorophenyl)phenyl]-5-methylpyridine |
|---|---|
| PubChem CID | 59294841 |
| Molecular Formula | C18H13F2N |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-[3-(2,3-difluorophenyl)phenyl]-5-methylpyridine |
| SMILES | Cc1ccc(-c2cccc(-c3cccc(F)c3F)c2)nc1 |
| InChI | InChI=1S/C18H13F2N/c1-12-8-9-17(21-11-12)14-5-2-4-13(10-14)15-6-3-7-16(19)18(15)20/h2-11H,1H3 |
| InChIKey | FFRKABJZGDCVEO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |