C19H14F3NO — CID 11209672
5-methyl-2-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyridine (PubChem CID 11209672) has the molecular formula C19H14F3NO and a molecular weight of 329.32 g/mol. Its IUPAC name is 5-methyl-2-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyridine.
| Compound Name | 5-methyl-2-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 11209672 |
| Molecular Formula | C19H14F3NO |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-methyl-2-[3-[2-(trifluoromethoxy)phenyl]phenyl]pyridine |
| SMILES | Cc1ccc(-c2cccc(-c3ccccc3OC(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C19H14F3NO/c1-13-9-10-17(23-12-13)15-6-4-5-14(11-15)16-7-2-3-8-18(16)24-19(20,21)22/h2-12H,1H3 |
| InChIKey | TYQJCTAPPYHSHY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |