C19H10F7NO — CID 58090397
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methylpyridine (PubChem CID 58090397) has the molecular formula C19H10F7NO and a molecular weight of 401.28 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methylpyridine.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methylpyridine |
|---|---|
| PubChem CID | 58090397 |
| Molecular Formula | C19H10F7NO |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-methylpyridine |
| SMILES | Cc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)nc1 |
| InChI | InChI=1S/C19H10F7NO/c1-9-2-3-16(27-8-9)10-4-12(20)17(13(21)5-10)19(25,26)28-11-6-14(22)18(24)15(23)7-11/h2-8H,1H3 |
| InChIKey | NPLIMVIKYYQJBQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|