C21H19N3 — CID 162692975
4-(3,5-dimethylphenyl)-8,10-dimethylpyrido[4,3-h]quinazoline (PubChem CID 162692975) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-8,10-dimethylpyrido[4,3-h]quinazoline.
| Compound Name | 4-(3,5-dimethylphenyl)-8,10-dimethylpyrido[4,3-h]quinazoline |
|---|---|
| PubChem CID | 162692975 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-8,10-dimethylpyrido[4,3-h]quinazoline |
| SMILES | Cc1cc(C)cc(-c2ncnc3c2ccc2cc(C)nc(C)c23)c1 |
| InChI | InChI=1S/C21H19N3/c1-12-7-13(2)9-17(8-12)20-18-6-5-16-10-14(3)24-15(4)19(16)21(18)23-11-22-20/h5-11H,1-4H3 |
| InChIKey | GMNUCGHCJHUOAW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|